CameraIcon
CameraIcon
SearchIcon
MyQuestionIcon


Question

Solid ammonium carbamate dissociates into NH3 and CO2 as NH2COONH4NH3(g)+CO2(g). The total pressure at equilibrium is 5 atm. Calculate the equilibrium constnat Kp.
  1. 37.04 atm2
  2. 22.52 atm2
  3. 18.52 atm2
  4. 45.04 atm2


Solution

The correct option is C 18.52 atm2
Given reaction is: 
NH2COONH4(s)2NH3(g)+CO2(g)
Given that total pressure of the gases in equilibrium, pT=5 atm
Kp=p2NH3.pCO2
using Dalton's law of partial pressure we have 
pi=χipT
thus, pNH3=χNH3pT
χNH3=nNH3nNH3+nCO2=22+1
χNH3=23
Similarly, χCO2=12+1=13
upon substitution we get: 
Kp=(23×5)2×(13×5)=50027
Kp=18.52 atm2

flag
 Suggest corrections
thumbs-up
 
0 Upvotes


Similar questions
QuestionImage
QuestionImage
View More...


People also searched for
View More...



footer-image