CameraIcon
CameraIcon
SearchIcon
MyQuestionIcon


Question

Which reaction can't be used for the preparation of the given halogen acid?
  1. 2KBr+H2SO4(conc)K2SO4+2HBr
  2. 2NaCl+H2SO4(conc)Na2SO4+2HCl
  3. CaF2+H2SO4(conc)CaSO4+2HF
  4. NaHSO4+NaClNa2SO4+HCl


Solution

The correct option is A 2KBr+H2SO4(conc)K2SO4+2HBr
The option (a) is incorrect because HBr is a stronger reducing agent than HCl, and thus it will get oxidised by H2SO4

flag
 Suggest corrections
thumbs-up
 
0 Upvotes


Similar questions
View More...



footer-image