In organic chemistry, alcohol and phenols are the compounds in which the hydrogen atom is replaced with the hydroxyl group. The primary difference between alcohols and phenols is that hydrogen is replaced by the hydroxyl group in aliphatic hydrocarbon in alcohols, while in phenols, hydrogen is replaced by the hydroxyl group in aromatic hydrocarbon. Ethers are compounds in which the oxygen atom links two alkyl groups.
Download Class 12 Chemistry Worksheet on Chapter 11 Alcohols, Phenols, and Ethers PDF – Set 2
CBSE Class 12 Chemistry Chapter 11 Alcohols, Phenols, and Ethers Worksheet – Set 2
Q1. Phosphorous pentachloride reacts with the ethanol to yield
(a) Ethylene chloride
(b) Ethyl chloride
(c ) Both (a) and (b)
(d) None of the above
Q2. What is the electrolytic product of 20% aqueous sodium chloride solution and ethanol?
(a) Chloroform
(b) Ethyl chloride
(c ) Formaldehyde
(d) None of the above
Q3. Which of the following will give a positive iodoform test?
(a) 1-pentanal
(b) 2-pentanone
(c ) 3-pentanal
(d) None of the above
Q4. What happens when ethanol reacts with methyl magnesium bromide?
(a) Methane
(b) Ethane
(c ) Propane
(d) None of the above
Q5. What is the molecular formula of chloral hydrate?
(a) CCl3CH(OH)2
(b) CCl3COCH3
(c ) CCl3COCCl3
(d) None of the above
Q6. Write the IUPAC name of the below-mentioned compound.
CH3-CH(CH3)-CH2-CH(OH)-CH(CH3)-CH2OH
Q7. Convert aniline to phenol.
Q8. Why is phenol acidic in nature?
Q9. Name a compound which is used as an antiseptic as well as a disinfectant.
Q10. What is a nitrating mixture?
Q11. Why is lower alcohol soluble in water while higher alcohol is insoluble in water?
Q12. What will happen if ethanol is heated with red phosphorous and hydroiodic acid?
Q13. Convert ethanol to ethene.
Q14. What is ether? Why are they used as a solvent?
Q15. What is power alcohol?
Q16. Why does phenol not give protonation reactions readily?
Q17. Why is ether inert?
Q18. Why is dehydration of alcohol carried out with sulphuric acid and not nitric acid or hydrochloric acid?
Q19. An alcohol A (C4H10O) on oxidation with acidified K2Cr2O7 gives carboxylic acid B (C4H8O2). Compound A when dehydrated with concentrated H2SO4 at 443 K gives compound C with aqueous H2SO4. C gives compound D (C4H10O) which is A’s isomer. Compound D is resistant to oxidation but compound A can oxidise easily. Identify A, B, C and D and write their structure.
Q20. An ether A (C5H12O), when heated with excess of hot concentrated HI, produced two alkyl halides which on getting hydrolysed gives compounds B and C. Oxidation of B gives an acid D,. In contrast, oxidation of C gives a ketone E. Draw the structures of A, B, C, D and E.
Download the PDF to access answers to the Chemistry Worksheet for Class 12 Chemistry Chapter 11 Alcohols, Phenols, and Ethers Set -2.
Download PDF
Comments