The term hydrocarbons mean compounds of hydrogen and carbon only. Hydrocarbons play an important role in our daily lives. You must be familiar with the fuel terms ‘LPG’ and ‘CNG.’ LPG is the abbreviated form for Liquified Petroleum Gas. CNG is an abbreviation for compressed natural gas. LNG is also making headlines these days. It is also a fuel that is obtained by liquefying natural gas. Hydrocarbons are also used in the production of polymers such as polythene, polypropene, and polystyrene. Higher hydrocarbons are used as paint solvents.
Download Class 11 Chemistry Worksheet on Chapter 13 Hydrocarbons – Set 1 PDF
Download PDF
CBSE Class 11 Chemistry Chapter 13 Hydrocarbons – Set 1
Q-1: Which of the following is the chemical formula of marsh gas?
a) C2H6
b) CH4
c) C2H2
d) C4H10
Q-2: What would the alkane’s formula be if one of the hydrogen atoms in propane was replaced by an ethyl group?
Q-3: Calculate the number of sigma and pi bonds in the following compounds:
a) 4-Ethyl-2-methylhexane
b) 3,3-Diethyl-5-isopropyl-4-methyloctane
c) 4-Ethyl-2,5,7-decatriene
Q-4: Give the IUPAC name for the following:
a) CH3-CH=CH2
b) CH2=C(CH3)2
c) CH3-CH2-C(CH3)=CH2
d) CH2=CH-CH=CH2
e) CH3-CH2-CH(CH2-CH3)-CH2-CH(CH3)-CH2-CH3
Q-5: What happens to the electron cloud of carbon-hydrogen bonds in an ethane molecule if the configuration is changed from staggered to eclipsed?
Q-6: Which of the following conformations has hydrogen atoms attached to two carbon atoms as close together as possible?
a) Staggered
b) Eclipsed
c) Skew
d) Gauche
Q-7: What type of isomerism do the compounds listed below exhibit?
Q-8: Why is benzene so hesitant to exhibit an addition reaction?
Q-9: Name the few catalysts used in aromatisation reactions.
Q-10: In Friedel-Crafts reaction, toluene can be prepared by
a) C6H6 + CH3Cl
b) C6H5Cl + CH4
c) C6H6 + CH2Cl2
d) C6H6 +CH3COCl
Q-11: In sulphonation of benzene, the electrophilic reagent used is
Q-12: How do you make benzene from aromatic acid decarboxylation?
Q-13: What are the products obtained when pentene undergoes addition reaction of HBr in different conditions?
a) In absence of peroxide
b) In presence of peroxide
Q-14: Why is alkane iodination done in the presence of oxidising agents?
Q-15: Write the structure of the compound 3,4-Diethyl-3,4-dimethyl heptane.
Q-16: Which acid’s sodium salt will be required for the preparation of butane? Write a chemical equation to represent the reaction.
Q-17: Why does pentane have a higher boiling point than 2,2-dimethylpropane?
Q-18:
a) What is the unit called from which polymers are made?
b) Which polymer is used for the making of milk crates?
Q-19: How many moles of dihydrogen is required to convert one mole of propyne into a saturated compound?
Q-20: How many moles of CO2 is produced when one mole of benzene undergoes combustion?
Download the access answers to the Chemistry Worksheet for Class 11 Chemistry Chapter 13 Hydrocarbons Set -1
Download PDF
