Stoichiometry

Q. 43. if the percentage of water of crystallization in mgso4.xh2o is 13%.whats is the value of x

Q.

The solubility product of $BaS{O}_4$ at ${25}^{\circ }C$ is $1.0\times {10}^{-9}$. What would be

the concentration of $H_{2}S{O}_4$ necessary to precipitate $BaS{O}_4$ from a solution

of $0.01M$ $B{a}^{2+}$ ions ?

1. 10^-9

2. 10^-8

3. 10^-7

4. 10^-6

Q.

Match the type of mixture of compounds in Column I with the technique of separation / purification given in Column II.

	Column I		Column II
A	Two solids which have different solubilities in a solvent and which do not undergo reaction when dissolved in it	$\left(i\right)$	Steam distillation
B	Liquid that decomposes at its boiling point	$\left(ii\right)$	Fractional distillation
C	Steam volatile liquid	$\left(iii\right)$	Simple distillation
D	Two liquids which have boiling points close to each other	$\left(iv\right)$	Distillation under reduced pressure
E	Two liquids with large difference in boiling points.	$\left(v\right)$	Crystallization

Q. if 8 gm O2 diffuses from a pin hole how much H2 will diffuse under similar condition

Q. 30. iupac name of [Ni(Gly)2] and why?

Q. 20. Solubility product of the salt, AxBy will be represented most suitablg if the solubility is represented by S is

Q. 23. If solubility product of the base M{(OH)}_3 is 2.7\ast10^{-11} the concentration of OH^-will be

Q. iupac name of (c2h5)2

Q.

Which of the following is not a Doebereiner triad-

1. S, Se, Te

2. Li, Na, K

3. Mg, Ca, Sr

4. Cl, Br, I

Q.

The number of molecules of water in 333 g of $A{l}_2(S{O}_4{)}_3$.18$H_{2}O$ is

1. 18.0 x 6.02 x 10²³

2. 9.0 x 6.02 x 10²³

3. 18.0

4. 36.0

Q. IUPAC name of CH2=CH-CH2- and CH3-CH=CH- groups respectively.

Q. 6. Ag2CrO4 Find out the general formula for solubility product if solubility is Smol/L

Q. 8. What is the IUPAC name of (CH3CH2)2NCH3

Q. A compact car gets $20$ miles per litre on the highway. Gasoline contains $84.0\%$ carbon by mass and has a density of $0.80gm{l}^{-1}$. The mass of $C{O}_2$ produced (in $g$) during a $50$ mile-trip is:

1. 6160

Q. The maximum amount of BaSO4 (in terms ofmoles) precipitated on mixing equal volumes one litre each of BaCl2(0.5M) with H2SO4 (1 M) willcorrespond to

Q. Write the industrial / commercial method of preparation of dihydrogen with equations.

Q.

Nitration of benzene by nitric acid and sulphuric acid is:

1. Nucleophilic substitution

2. Free radical substitution

3. Electrophilic addition

4. Electrophilic substitution

Q.

Which of the following acts as a buffer solution ?

1. 500 ml of 0.1 M-CH₃COOH + 1 litre 0.1 M-KOH solution mixture

2. 1 litre of 0.1 M-CH₃COOH + 1 litre 0.1 M-KOH solution mixture

3. 1 litre of 1 M-CH₃COOH + 500 ml of 1 M-KOH solution mixture

4. 1 litre 0.1 M-CH₃COOH + 500 ml of 0.2 M-KOH solution mixture

Q. If $1\frac{1}{2}$ moles of oxygen combine with Al to form $A{l}_2{O}_3$, the weight of Al used in the reaction is: (atomic wt of Al = 27 u)

1. 27 g
2. 54 g
3. 40.5 g
4. 81 g

Q. 50mL of ammonia undergoes oxidation with 60 mL of oxygen. If the reaction continues till one of the gases is completely consumed, the volume of water vapour produced will be?

Q.

How many moles of oxygen atoms are present in ${\mathrm{Fe}}_2{\mathrm{O}}_3$.

Q. 10 ml of H_{2 }contain 2000 molecules under certain temperature and pressure. Calculate the number of molecules of oxygen whose volume is 150 ml at the same temperature and pressure .

Q. the iupac name of the compound is CH3CH=CHCH=CHC≡ CCH3 ?

Q. 1.What is the structure and IUPAC name of - CH3Cl(p-ClC6H4)2-CH(Br)CH3

Q. rhombic sulphur is a most a most stable form ?and why?

Q. 31. How to write a balanced chemical equation when phosphorus reacts with chlorine gas to form phosphorus pentachloride?

Q. 0.3 g of an acid is neutralised by 40 cm3 of 0.125 N NaOH. Equivalent mass of the acid is

Q. At stp some molecules of h2(g) occupy a volume of X litres . Under the same condition volume occupied by half the number of molecules of O3 ( ozone) gas is ? 1. X L 2. X/2 L 3. 2X L 4. X/4

Q. IUPAC name of Neo-hep†an e

Q. 10.The value of Kc=4.24 at 800k for the reaction CO+H2O gives out CO2+H2 calculate equilibrium concentration of CO2, H2, CO, H2O if only CO and H2O are present initially at concentration of 0.10M each.