Nomenclature of Ethers

Q. IUPAC name of

1. 2-Oxo pentane
2. 2-Ethoxy propane
3. 2-Propanol
4. 2- Propoxy ethane

Q. The correct IUPAC name for the following compound is :

1. 3-phenylbutan-2-one
2. 1-phenylbutan-2-one
3. 2-oxo-benzylbutane
4. 2-phenylbutan-1-one

Q.

Oxiran is

1. Ethylene oxide

2. Diethyl ether

3. Ethyl glycolate

4. Glycolic ester

Q. what is the iupac name of this compound ? and what is the oxidation no of co? K\lbrack Cocl2(NH3)3(H2O)(ONO)\rbrack

Q.

Oxiran is

1. Ethylene oxide

2. Diethyl ether

3. Ethyl glycolate

4. Glycolic ester

Q. IUPAC name of

1. 2-Oxo pentane
2. 2- Propoxy ethane
3. 2-Ethoxy propane
4. 2-Propanol

Q. IUPAC name with explanation:
[Co(NH3)4Cl(NO2)]Cl

Q. The IUPAC name of the given compound:

1. bicyclo [3, 3, 1] octane
2. bicyclo [3, 3] octane
3. bicyclo [3, 3, 0] octane
4. spiro [3, 3] octane

Q. Assertion :The IUPAC name for is 7-oxabicyclo [4.1.0] heptane Reason: The prefix oxo is used for the given group

1. Both Assertion and Reason are correct and Reason is the correct explanation for Assertion
2. Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion
3. Assertion is correct but Reason is incorrect
4. Assertion is incorrect but Reason is correct