Acidity of acid produced when conc. nitric acid reacts with calcium phosphate is :

Open in App

Solution

${{C a}_{3} ({P O}_{4})}_{2} + c o n c . {H N O}_{3} ⟶ {C a (H_{2} {P O}_{4})}_{2} + C a {({N O}_{3})}_{2}$
${C a (H_{2} {P O}_{4})}_{2} ⟶ H_{2} O H_{3} {P O}_{4} + {C a (O H)}_{2}$
acidity of $H_{3} {P O}_{4}$ is $3$ .

Suggest Corrections

Similar questions

Q. Which gases are evolved when Cu reacts with dil. nitric acid and when Zn reacts with conc. Nitric acid?

Q. Which gas is released when iron reacts with conc nitric acid?

What happens when calcium bisulphite reacts with dilute nitric acid?

(a) Dilute nitric acid is generally considered a typical acid except for its reaction with metals. In what way is dilute nitric acid different from other acids when it reacts with metals?

(b) Write the equation for the reaction of dilute nitric acid and conc. nitric acid with copper.

Which of the following gas is released when sulphur reacts with conc. nitric acid?

Join BYJU'S Learning Program

Acidity of acid produced when conc. nitric acid reacts with calcium phosphate is :

Ca3(PO4)2+conc.HNO3⟶Ca(H2PO4)2+Ca(NO3)2Ca(H2PO4)2⟶H2OH3PO4+Ca(OH)2acidity of H3PO4 is 3.

${{C a}_{3} ({P O}_{4})}_{2} + c o n c . {H N O}_{3} ⟶ {C a (H_{2} {P O}_{4})}_{2} + C a {({N O}_{3})}_{2}$
${C a (H_{2} {P O}_{4})}_{2} ⟶ H_{2} O H_{3} {P O}_{4} + {C a (O H)}_{2}$
acidity of $H_{3} {P O}_{4}$ is $3$ .