The equivalent n factor of Ca(OH)2 and H3PO4 in Ca(OH)2+H3PO4=CaHPO4+2H2O is?

Open in App

Solution

Dear Student,

In the above mentioned chemical reaction there are two equivalent of hydroxide ion (OH^-) removed from Ca(OH)₂ and in a similar way, two equivalent of hydrogen ion (H⁺) are removed from H₃PO₄.

Therefore the equivalent n-factor for Ca(OH)₂ and H₃PO₄ will be 2.

Best Wishes !

Suggest Corrections

Similar questions

The equivalent weight of H3PO4 in following reaction

H3PO4 + Ca(OH)2 ---> CaHPO4 +2 H2O

{H_{3} P O}_{4}

{H_{3} P O}_{4} + C a {(O H)}_{2} ⟶ {C a H P O}_{4} + 2 H_{2} O

C a (O H)_{2} + H_{3} P O_{4} \to C a H P O_{4} + 2 H_{2} O

H_{3} P O_{4}

H_{3} P O_{4}

C a (O H)_{2} + H_{3} P O_{4} \to C a H P O_{4} + 2 H_{2} O

C a (O H)_{2} + H_{3} P O_{4} \to C a H P O_{4} + 2 H_{2} O

H_{3} P O_{4}

Join BYJU'S Learning Program