The potential of the cell at 25∘C is
Pt|H2(1 atm)|CH3COONa(0.1M)+CH3COOH(0.01M)||NH4Cl(0.2M)+NH4OH(0.1M)|H2(1 atm)|Pt
Given: pKa of CH3COOH and pKb of NH4OH=4.74
This is an example of a concentration cell where anode is an acidic buffer and cathode is a basic buffer.
At anode,
pH = pKa + logsaltacid
= 4.74 + log0.10.01
= 4.74 + log10
= 5.74
At cathode,
pOH = pKb + logsaltacid
= 4.74 + log0.20.1
= 4.74 + log2
= 5.04
Pt|H2(1 atm)|CH3COONa(0.1M)+CH3COOH(0.01M)||NH4Cl(0.2M)+NH4OH(0.1M)|H2(1 atm)|Pt
Which is same as,
Pt|H2(1 atm)|H+ox||H+red|H2(1 atm)|Pt
H2 → 2H+ox + 2e−
2H+red + 2e−→ H2
E = −0.0592 log[H+ox]2[H+red]2
=−0.0592 log[H+ox][H+red]2
=−0.059 log[H+ox][H+red]
=−0.059 log[H+ox] [OH−red]Kw
=0.059 [−log[H+ox]−log[OH−red]−log[1Kw]]
= 0.059× (5.74+5.04−14)
= 0.059 × (−3.22)
= -0.189