Question

the reaction between 15 gram of marble and nitric acid is given by the following reaction:
caco3+2hno3=ca(no3)2+h2o+co2
find the volume of CO2 evolved at stp
Calculate:(1) the mass of anhydrous calcium nitrate formed,

Answer 1

1. Number of moles of CaCO₃ = $\frac{15}{100}=0.15moles$

2. According to the reaction provided in question:

1 mole of CaCO_​3 gives 1 mole of CO₂
So, 0.15 moles of CaCO₃ gives 0.15 moles of CO2

Mass of CO₂ = Number of moles $\times$ Molar mass of CO₂
= 0.15 $\times$ 44.01 = 6.6g

Density of CO₂ = $\frac{mass}{volume}$
Volume = 1.977 $\times$ 6.6 = 13.04 ml of CO₂ is formed.

3. 1 mole of CaCO₃ gives 1 mole of Ca(NO₃)₂
So, 0​.15 mole of CaCO₃ gives 0.15 mole of Ca(NO₃)₂

Mass of ​Ca(NO₃)₂ = Number of moles $\times$ Molar mass of Ca(NO₃)₂
= 0.15 $\times$ 164.088 = 24.61g