Two half reactions for the following equation are:
$4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$

Right on! Give the BNAT exam to get a 100% scholarship for BYJUS courses

No worries! We‘ve got your back. Try BYJU‘S free classes today!

None of these

No worries! We‘ve got your back. Try BYJU‘S free classes today!

Open in App

Solution

The correct options are
A

B

$K_{2} C r_{2} O_{7} + N a_{2} S O_{3} ⟶ C r^{+ 3} + S O_{4}^{2 -}$

Now, Basic skeleton eq is:

$C r_{2} O_{7}^{- 2} + S O_{3}^{2 -} ⟶ C r^{+ 3} + S O_{4}^{- 2}$

$C r_{2} O_{7}^{- 2} ⟶ C r^{+ 3}$

$S O_{3}^{- 2} ⟶ S O_{4}^{- 2}$

Suggest Corrections

Similar questions

Two half reactions for the following equation are:
$4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$

Q. According to the following equation,

K_{2} C r_{2} O_{7} + 4 H_{2} S O_{4} \to K_{2} S O_{4} + C r_{2} (S O_{4})_{3} + 4 H_{2} O + 3 [O]

the equivalent mass of

K_{2} C r_{2} O_{7}

Q. Balance the following chemical equation:

C r_{2} O_{7}^{- 2} (a q) + S O_{3}^{- 2} (a q) \to C r^{+ 3} (a q) + S O_{4}^{- 2} (a q)

(Acidic medium)

When $N a N O_{2}$ is oxidised by $K_{2} C r_{2} O_{7}$ , the important products formed are

Identify the monoatomic and polyatomic ions from the following equation-
$P b (N O_{3})_{2}$ + $K_{2} S O_{4}$ $\to$ $2 K N O_{3}$ + $P b S O_{4}$

Join BYJU'S Learning Program

Two half reactions for the following equation are: 4H2SO4+K2Cr2O7+3Na2SO3⟶Cr2(SO4)3+K2SO4+3Na2SO4+4H2O

The correct options are A B K2Cr2O7+Na2SO3⟶Cr+3+SO2−4 Now, Basic skeleton eq is: Cr2O−27+SO2−3⟶Cr+3+SO−24 Cr2O−27⟶Cr+3 SO−23⟶SO−24

Two half reactions for the following equation are:
$4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$

The correct options are
A

B

$K_{2} C r_{2} O_{7} + N a_{2} S O_{3} ⟶ C r^{+ 3} + S O_{4}^{2 -}$

Now, Basic skeleton eq is:

$C r_{2} O_{7}^{- 2} + S O_{3}^{2 -} ⟶ C r^{+ 3} + S O_{4}^{- 2}$

$C r_{2} O_{7}^{- 2} ⟶ C r^{+ 3}$

$S O_{3}^{- 2} ⟶ S O_{4}^{- 2}$