Write structural formulae of the organic compounds $^{'} A^{'},^{'} B^{'},^{'} C^{'}$ and $^{'} D^{'}$ in the following sequence of reaction.
$^{'} A^{'} + C H_{3} M g B r H_{2} O - - \to C H_{3} C H_{2} C H (O H) C H_{3} c o n c . H_{2} S O_{4} - ------ \to^{'} B^{'} B r_{2} - - \to^{'} C^{'} a l c . K O H - ---- \to^{'} D^{'}$ .

Open in App

Solution

Aldehydes and Ketones form alcohol with Grignard reagent. As the secondary alchohol formed with a 3-carbon chained. So, $A$ is propanol.
2-butanol is a secondary alcohol and on dehydration with sulphuric acid forms forms trans-2-butene.
Butene on reaction with Bromine gives 2,3 dibromo butane.
This forms 2-bromo but-2-ene on reaction with alchoholic KOH.

Suggest Corrections

Similar questions

Q. Write structural formulae of the organic compounds 'A', 'B', 'C' and 'D' in the following sequence of reactions: 'A'

+ C H_{3} M g B r - H_{2} O \to C H_{3} C H_{2} C H (O H) C H_{3}

-conc.

H_{2} S O_{4} \to^{'} B^{'} - B r_{2} \to^{'} C^{'} - a l c . K O H \to^{'} D^{'}

Three organic compounds A, B and C have the following molecular formulae :
A $C_{4} H_{8} O_{2}$
B $C_{4} H_{10} O$
C $C_{4} H_{8} O$
(a) Which compound contains an alcohol group? Write its name and structural formula.
(b) Which compound contains a carboxyl group? Write its name and structural formula.
(c) Which molecular formula can represent an aldehyde as well as a ketone? Write the names and structural formulae of the aldehyde and ketone represented by this molecular formula.

Q. In the following sequence of reactions, identify the compounds (A), (B), (C) and (D):

N a_{2} C O_{3} S O_{2} - - \to (A) N a_{2} C O_{3} - ---- \to (B) S \to (C) A g N O_{3} - --- \to (D)

Q. Two organic compounds A and B have the same molecular formula C₆H₁₂. Write the names and structural formulae:
(a) if A is a cyclic compound
(b) if B is an open chain compound
(c) Which compound contains single bonds as well as a double bond?
(d) Which compound contains only single bonds?

In the following sequence of reactions, products A, B, C, D and E are formed.

The structure of product (A) is:

Join BYJU'S Learning Program

Write structural formulae of the organic compounds ′A′,′B′,′C′ and ′D′ in the following sequence of reaction.′A′+CH3MgBrH2O−−→CH3CH2CH(OH)CH3conc.H2SO4−−−−−−−→′B′Br2−−→′C′alc.KOH−−−−−→′D′.