Write the balanced chemical equation for the following:
(i) Silver chloride is treated with aqueous sodium cyanide and the product thus formed is allowed to react with zinc in an alkaline medium.
(ii) Cobalt(II) solution reacts with $K N O_{2}$ in acetic acid medium.

Open in App

Solution

(i) Silver goes into the complex, and then it is displaced with zinc.

$A g C l + 2 N a C N \to N a C l + N a [A g (C N)_{2}]$
$2 N a [A g (C N)]_{2} + Z n \to N a_{2} [Z n (C N)_{4}] + 2 A g ↓$
(ii) Yellow precipitate is formed.
$K N O_{2} + C H_{3} C O O H \to C H_{3} C O O K + H N O_{2}$

$C o C l_{2} + 2 K N O_{2} \to C o (N O_{2})_{2} + 2 K C l$
$C o (N O_{2})_{2} + 2 H N O_{2} \to C o (N O_{2})_{3} + N O + H_{2} O$
$C o (N O_{2})_{3} + 3 K N O_{2} \to K_{3} [C o (N O_{2})_{6}]$

Suggest Corrections

Similar questions

Q. (a) Substitute formulae for names and balance the following equation:
Calcium carbonate reacts with hydrochloric acid to produce calcium chloride, water and carbon dioxide gas.
(b) Write balanced chemical equation with state symbols for the following reaction:
Sodium hydroxide solution reacts with hydrochloric acid solution to produce sodium chloride solution and water.

Write the balanced chemical equations for the following:

Silver chloride is treated with aqueous sodium cyanide and the product thus formed is allowed to react with zinc with zinc in an alkaline medium.

Q. Balance the chemical equation by including the physical states of the substances for the following reactions.

a) Barium chloride and sodium sulphate aqueous solutions react to give insoluble Barium sulphate and an aqueous solution of sodium chloride.

b) Sodium hydroxide reacts with hydrochloric acid to produce sodium chloride and water.

c) Zinc pieces react with dilute hydrochloric acid to liberate hydrogen gas and forms zinc chloride

Q. Write a balanced chemical equation for and also CLASSIFY THEM:
(A) Lead acetate solution is treated with dilute hydrochloric acid to form lead chloride and acetic acid solution.
(B)A piece of sodium metal is added to absolute ethanol to form sodium ethoxide and hydrogen gas.
(C) Hydrogen sulphide reacts with oxygen gas to form solid sulphur and liquid water.

Write a balanced chemical equation for the given reaction and also classify them: Lead acetate solution is treated with dilute hydrochloric acid to form lead chloride and acetic acid solution.

Join BYJU'S Learning Program

Write the balanced chemical equation for the following:(i) Silver chloride is treated with aqueous sodium cyanide and the product thus formed is allowed to react with zinc in an alkaline medium.(ii) Cobalt(II) solution reacts with KNO2 in acetic acid medium.

(i) Silver goes into the complex, and then it is displaced with zinc.AgCl+2NaCN→NaCl+Na[Ag(CN)2]2Na[Ag(CN)]2+Zn→Na2[Zn(CN)4]+2Ag↓(ii) Yellow precipitate is formed.KNO2+CH3COOH→CH3COOK+HNO2 CoCl2+2KNO2→Co(NO2)2+2KClCo(NO2)2+2HNO2→Co(NO2)3+NO+H2O Co(NO2)3+3KNO2→K3[Co(NO2)6]

Write the balanced chemical equation for the following:
(i) Silver chloride is treated with aqueous sodium cyanide and the product thus formed is allowed to react with zinc in an alkaline medium.
(ii) Cobalt(II) solution reacts with $K N O_{2}$ in acetic acid medium.