Bond Order and Enthalpy

Q.

Out of ${\mathrm{NO}}^{+}$, ${\mathrm{NO}}_2^{-}$, and ${\mathrm{NO}}_3^{-}$ which has the longest $\mathrm{NO}$ bond and which has the shortest $\mathrm{NO}$ bond?

Q.

Use bond energies to estimate the enthalpy of formation of HBr(g).
BE(H-H) = 436 kJ/mol
BE(Br-Br) = 192 kJ/mol
BE(H-Br) = 366 kJ/mol

1. +152 kJ/mol

2. −104 kJ/mol

3. +262 kJ/mol

4. −52 kJ/mol

Q.

Bond energies in $NO,N{O}^{+}$ and $N{O}^{-}$ are such as

1. 

2. 

3. 

4. 

Q. Bond enthalpy is defined as the amount of energy required to break one mole of bonds of a particular type in gaseous state.

1. False
2. True

Q.

Bond enthalpy is defined as the amount of energy required to break one mole of bonds of a particular type between two atoms in a gasesous state (True/False)

1. True
2. False

Q. Nacl and agcl which is more covalent and in kcl agcl which is more covalent and in group covalent character increases or decreases

Q.

Which of the following is a possible electronic configuration?

1. 1s² 2s² 2p⁶ 3s² 3p⁴

2. 1s² 2s³ 2p⁶

3. 1s² 2s² 2p⁶ 3s² 3p⁸ 3d⁷

4. 1s² 2s² 2p⁶ 3s² 3d¹²

Q. Most stable radical among the following is(1) CH3-CH2.(2) F-CH2-CH2.(3)(F)2-CH-CH2. (4) (F)3-C-CH2

Q. 48. In the absence of Paulis exclusion principle the electronic configuration of Li is (a) 1s3 (b) 1s2, 2p1 (c)1s2, 2s1 (d)1s1, 2s1, 2p1

Q.

In the following which bond will be responsible for maximun value of hydrogen bond

1. F−H

2. O−H

3. N−H

4. S−H

Q. 37.Give the formal charge Nd average bond order of XO bond in the following. (NO2)- (ClO2)- (ClO3)- (ClO4)- (the numbers r the subscript)

Q. Select the correct statement(s) about the compound $NO\left[B{F}_4\right]$ :

1. Magnetic moment of the species is zero
2. $B-F$ bond energy is lower in this compound than in $B{F}_3$
3. It has $5\sigma$ and $2\pi$ bond
4. Nitrogen oxygen bond order is same as in $N_2$

Q. the energy of hydrogen atom in ground state is -13.6eV.its energy correspondent to the quantum number n=5 is

Q. In dichromate ion(44 Cr - O bonds are equal(2) 6 Cr- O bonds are equal(3) All Cr - O bonds are equal(4) All Cr - O bonds are unequal

Q. Which of the following is a polar molecule?

निम्नलिखित में से ध्रुवीय अणु कौनसा है?

1. CO₂
2. XeF₄
3. NH₃
4. PF₂Cl₃

Q. In vsepr theory we dont consider double bonds. So why does the structure of SO2 have double bonds ?

Q. Applying Aufbau principle, write the electronic configuration of element with Z=21.

Q.

Correct order of bond length is-

1. 

2. 

3. 

4. None of these

Q. Which of the following options represents the correct bond order?

1. $O_2^{-}<O_2>O_2^{+}$
2. $O_2^{-}>O_2>O_2^{+}$
3. $O_2^{-}<O_2<O_2^{+}$
4. $O_2^{-}>O_2<O_2^{+}$

Q.

Which of the following represent the correct electronic configuration of $O_2$?

1. $\left(\sigma 1s{)}^2\right({\sigma }^{\ast }1s{)}^2\left(\sigma 2s{)}^2\right({\sigma }^{\ast }2s{)}^2\left(\sigma 2p_z{)}^2\right(\pi 2p_{x^2}\equiv \pi 2p_{y^2}\left)\right({\pi }^{\ast }2p_{x^1}\equiv {\pi }^{\ast }2p_{y^1})$

2. $\left(\sigma 1s{)}^2\right({\sigma }^{\ast }1s{)}^2\left(\sigma 2s{)}^2\right({\sigma }^{\ast }2s{)}^2\left(\sigma 2p_z{)}^2\right(\pi 2p_{x^2}\equiv \pi 2p_{y^2}\left)\right({\pi }^{\ast }2p_{x^2})$

3. $\left(\sigma 1s{)}^2\right({\sigma }^{\ast }1s{)}^2\left(\sigma 2s{)}^2\right({\sigma }^{\ast }2s{)}^2\left(\sigma 2p_z{)}^2\right(\pi 2p_{x^2}\equiv \pi 2p_{y^2}\left)\right({\pi }^{\ast }2p_{y^2})$

4. $\left(\sigma 1s{)}^2\right({\sigma }^{\ast }1s{)}^2\left(\sigma 2s{)}^2\right({\sigma }^{\ast }2s{)}^2\left(\sigma 2p_z{)}^2\right(\pi 2p_{x^2}\equiv \pi 2p_{y^2}\left)\right({\pi }^{\ast }2p_{y^2})$

Q. 41. Whats the c-o bond order in co, co3 -2, co2

Q. for principle quantum number n=4 the total number of orbitals having l=3 are

Q. Which of the following bonds has the highest bond energy?

1. $C-C$
2. $C\equiv C$
3. $C=C$
4. $C-H$

Q. What is the hybridization of phosphorus in $PC{l}_5$?

Q.

Bond enthalpy is defined as the amount of energy required to break one mole of bonds of a particular type between two atoms in a gasesous state (True/False)

1. True
2. False

Q.

Which of the following configurations represents atoms of the elements having the highest second ionization energy

1. 

2. 

3. 

4. 

Q. Pick out the incorrect statement?

1. $N_2$ has greater dissociation energy than $N_2^{+}$
2. $O_2$ has lower dissociation energy than $O_2^{+}$
3. Bond length in $N_2^{+}$ is less than $N_2$
4. Bond length in $N{O}^{+}$ is less than in $NO$

Q. Why does water have a high boiling point compared to H₂S?

Q. $H_2,L{i}_2,B_2$ each has bond order equal to 1, the order of their stability is :

1. $H_2=L{i}_2=B_2$
2. $H_2>L{i}_2>B_2$
3. $H_2>B_2>L{i}_2$
4. $B_2>L{i}_2<H_2$

Q. Suggest reasons why the $BF$ bond lengths in $B{F}_3$ (130 pm) and ${B{F}_4}^{-}$ (143 pm) differ.