Two half reactions for the following equation are:
$4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$

$C r_{2} O_{7}^{2 -}$ $⟶$ $C r^{+ 3}$

Right on! Give the BNAT exam to get a 100% scholarship for BYJUS courses

$S O_{3}^{- 2}$ $⟶$ $S O_{4}^{- 2}$

Right on! Give the BNAT exam to get a 100% scholarship for BYJUS courses

$S O_{3}^{- 2}$ $⟶$ $C r^{+ 3}$ $+ S O_{4}^{- 2}$

No worries! We‘ve got your back. Try BYJU‘S free classes today!

None of these

No worries! We‘ve got your back. Try BYJU‘S free classes today!

Open in App

Solution

The correct option is B
$S O_{3}^{- 2}$ $⟶$ $S O_{4}^{- 2}$

$K_{2} C r_{2} O_{7} + N a_{2} S O_{3} ⟶ C r^{+ 3} + S O_{4}^{2 -}$

Now, Basic skeleton eq is:

$C r_{2} O_{7}^{- 2} + S O_{3}^{2 -} ⟶ C r^{+ 3} + S O_{4}^{- 2}$

$C r_{2} O_{7}^{- 2} ⟶ C r^{+ 3}$

$S O_{3}^{- 2} ⟶ S O_{4}^{- 2}$

Suggest Corrections

Similar questions

Two half reactions for the following equation are:
$4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$

Q. According to the following equation,

K_{2} C r_{2} O_{7} + 4 H_{2} S O_{4} \to K_{2} S O_{4} + C r_{2} (S O_{4})_{3} + 4 H_{2} O + 3 [O]

the equivalent mass of

K_{2} C r_{2} O_{7}

Q. Represent the following equation in ionic form.

K_{2} C r_{2} O_{7} + 7 H_{2} S O_{4} + 6 F e S O_{4} \to 3 F e_{2} (S O_{4})_{3} + C r_{2} (S O_{4})_{3} + 7 H_{2} O + K_{2} S O_{4}

Q. Consider the following reaction:

6 F e S O_{4} + K_{2} C r_{2} O_{7} + 7 H_{2} S O_{4} \to 3 F e_{2} (S O_{4})_{3} + C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 7 H_{2} O

. How many electrons are involved in the redox reaction?

Q. Balance the following equation by oxidation number method.

K_{2} C r_{2} O_{7} + F e S O_{4} + H_{2} S O_{4} \to C r_{2} (S O_{4})_{3} + F e_{2} (S O_{4})_{3} + K_{2} S O_{4} + H_{2} O

Join BYJU'S Learning Program

Two half reactions for the following equation are: 4H2SO4+K2Cr2O7+3Na2SO3⟶Cr2(SO4)3+K2SO4+3Na2SO4+4H2O

The correct option is B SO−23⟶SO−24 K2Cr2O7+Na2SO3⟶Cr+3+SO2−4 Now, Basic skeleton eq is: Cr2O−27+SO2−3⟶Cr+3+SO−24 Cr2O−27⟶Cr+3 SO−23⟶SO−24

Two half reactions for the following equation are:
$4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$