The correct option is B Vegetable oils (l)+H2(g)Ni(s)⟶Vegetable ghee (s)
Catalyst can be classified into many types based on different parameters.
On the basis of phases, the catalyst is of two types,
1. Homogeneous catalyst
2. Heterogeneous catalyst
Homogeneous catalyst:
When catalysts and reactants are in the same phase, then the catalyst is called homogeneous catalyst and the process is called homogenous catalysis.
Example:
1. CH3COOC2H5(l)+H2O(l)HCl(l)⟶CH3COOH(aq)+CH3OH(aq)
2. 2SO2(g)+O2(g)NO(g)⟶2SO3(g)
3. C12H22O11(aq)+H2O(l)H2SO4(l)⟶C6H12O6(aq)+C6H12O6(aq)
In all these, both the catalyst and reactants are in same phase so it is a homogeneous catalyst.
Heterogeneous catalyst:
When catalysts and reactants are in different phase, then the catalyst is called heterogeneous catalyst and the process is called heterogeneous catalysis.
Example:
1. 2SO2(g)+O2(g)Pt(s)⟶2SO3(g)
2. Vegetable oils (l)+H2(g)Ni(s)⟶Vegetable ghee (s)
3. 4NH3(g)+5O2(g)Pt(s)⟶4NO(g)+6H2O(g)
Here, both the catalyst and reactants are in different phase so it is a homogeneous catalysis.